C25H33N3O7 — CID 5205495
[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 5205495) has the molecular formula C25H33N3O7 and a molecular weight of 487.55 g/mol. Its IUPAC name is [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 5205495 |
| Molecular Formula | C25H33N3O7 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)COC(=O)c1[nH]c(C)c(C(C)=O)c1C |
| InChI | InChI=1S/C25H33N3O7/c1-6-33-20-13-19(28-8-10-32-11-9-28)21(34-7-2)12-18(20)27-22(30)14-35-25(31)24-15(3)23(17(5)29)16(4)26-24/h12-13,26H,6-11,14H2,1-5H3,(H,27,30) |
| InChIKey | BZWZTQDVLVFKRQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|