C28H34N2O8 — CID 4832648
[2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate (PubChem CID 4832648) has the molecular formula C28H34N2O8 and a molecular weight of 526.59 g/mol. Its IUPAC name is [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4832648 |
| Molecular Formula | C28H34N2O8 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | [2-(2,5-diethoxy-4-morpholin-4-ylanilino)-2-oxoethyl] 3-(ethoxymethyl)-1-benzofuran-2-carboxylate |
| SMILES | CCOCc1c(C(=O)OCC(=O)Nc2cc(OCC)c(N3CCOCC3)cc2OCC)oc2ccccc12 |
| InChI | InChI=1S/C28H34N2O8/c1-4-33-17-20-19-9-7-8-10-23(19)38-27(20)28(32)37-18-26(31)29-21-15-25(36-6-3)22(16-24(21)35-5-2)30-11-13-34-14-12-30/h7-10,15-16H,4-6,11-14,17-18H2,1-3H3,(H,29,31) |
| InChIKey | ZTNHDLUEBQSXEP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|