C24H29ClN2O5 — CID 26664489
4-(4-chlorophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxobutanamide (PubChem CID 26664489) has the molecular formula C24H29ClN2O5 and a molecular weight of 460.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 26664489 |
| Molecular Formula | C24H29ClN2O5 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxobutanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H29ClN2O5/c1-3-31-22-16-20(27-11-13-30-14-12-27)23(32-4-2)15-19(22)26-24(29)10-9-21(28)17-5-7-18(25)8-6-17/h5-8,15-16H,3-4,9-14H2,1-2H3,(H,26,29) |
| InChIKey | ABNNSHZTKLRYDG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|