C22H28N2O5S — CID 26663462
N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxo-4-thiophen-2-ylbutanamide (PubChem CID 26663462) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxo-4-thiophen-2-ylbutanamide.
| Compound Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxo-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 26663462 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-(2,5-diethoxy-4-morpholin-4-ylphenyl)-4-oxo-4-thiophen-2-ylbutanamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C22H28N2O5S/c1-3-28-19-15-17(24-9-11-27-12-10-24)20(29-4-2)14-16(19)23-22(26)8-7-18(25)21-6-5-13-30-21/h5-6,13-15H,3-4,7-12H2,1-2H3,(H,23,26) |
| InChIKey | QZJCOYDWRCPQSN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|