C28H41N3O5 — CID 26717033
N-[3-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 26717033) has the molecular formula C28H41N3O5 and a molecular weight of 499.65 g/mol. Its IUPAC name is N-[3-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 26717033 |
| Molecular Formula | C28H41N3O5 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | N-[3-(2,5-diethoxy-4-morpholin-4-ylanilino)-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H41N3O5/c1-3-35-24-15-23(31-7-9-34-10-8-31)25(36-4-2)14-22(24)30-26(32)5-6-29-27(33)28-16-19-11-20(17-28)13-21(12-19)18-28/h14-15,19-21H,3-13,16-18H2,1-2H3,(H,29,33)(H,30,32) |
| InChIKey | IBCCKEHTOJNNAO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|