C24H34N2O4 — CID 16557267
N-[3-(3,4-diethoxyanilino)-3-oxopropyl]adamantane-1-carboxamide (PubChem CID 16557267) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[3-(3,4-diethoxyanilino)-3-oxopropyl]adamantane-1-carboxamide.
| Compound Name | N-[3-(3,4-diethoxyanilino)-3-oxopropyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 16557267 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | N-[3-(3,4-diethoxyanilino)-3-oxopropyl]adamantane-1-carboxamide |
| SMILES | CCOc1ccc(NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)cc1OCC |
| InChI | InChI=1S/C24H34N2O4/c1-3-29-20-6-5-19(12-21(20)30-4-2)26-22(27)7-8-25-23(28)24-13-16-9-17(14-24)11-18(10-16)15-24/h5-6,12,16-18H,3-4,7-11,13-15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | OGFZAVSZDGPYNR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |