C25H33N3O5 — CID 55781631
methyl 2-[[2-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl]acetyl]amino]acetate (PubChem CID 55781631) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is methyl 2-[[2-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 55781631 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | methyl 2-[[2-[4-[3-(adamantane-1-carbonylamino)propanoylamino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)CCNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H33N3O5/c1-33-23(31)15-27-22(30)11-16-2-4-20(5-3-16)28-21(29)6-7-26-24(32)25-12-17-8-18(13-25)10-19(9-17)14-25/h2-5,17-19H,6-15H2,1H3,(H,26,32)(H,27,30)(H,28,29) |
| InChIKey | CNEPPAIIGZGVEV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |