C26H37N3O4 — CID 108920619
tert-butyl N-[3-[[4-(adamantane-1-carbonylamino)phenyl]methylamino]-3-oxopropyl]carbamate (PubChem CID 108920619) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is tert-butyl N-[3-[[4-(adamantane-1-carbonylamino)phenyl]methylamino]-3-oxopropyl]carbamate.
| Compound Name | tert-butyl N-[3-[[4-(adamantane-1-carbonylamino)phenyl]methylamino]-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 108920619 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | tert-butyl N-[3-[[4-(adamantane-1-carbonylamino)phenyl]methylamino]-3-oxopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccc(NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C26H37N3O4/c1-25(2,3)33-24(32)27-9-8-22(30)28-16-17-4-6-21(7-5-17)29-23(31)26-13-18-10-19(14-26)12-20(11-18)15-26/h4-7,18-20H,8-16H2,1-3H3,(H,27,32)(H,28,30)(H,29,31) |
| InChIKey | LGPKAVSHLPGBAN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |