C20H25N3O4S — CID 108920560
tert-butyl N-[3-oxo-3-[[4-(thiophene-2-carbonylamino)phenyl]methylamino]propyl]carbamate (PubChem CID 108920560) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[4-(thiophene-2-carbonylamino)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[4-(thiophene-2-carbonylamino)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108920560 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[4-(thiophene-2-carbonylamino)phenyl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-20(2,3)27-19(26)21-11-10-17(24)22-13-14-6-8-15(9-7-14)23-18(25)16-5-4-12-28-16/h4-9,12H,10-11,13H2,1-3H3,(H,21,26)(H,22,24)(H,23,25) |
| InChIKey | YMMLPKVKTQNZQS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |