C18H25N3O4 — CID 108920722
tert-butyl N-[3-oxo-3-[[4-(prop-2-enoylamino)phenyl]methylamino]propyl]carbamate (PubChem CID 108920722) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[4-(prop-2-enoylamino)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[4-(prop-2-enoylamino)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108920722 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[4-(prop-2-enoylamino)phenyl]methylamino]propyl]carbamate |
| SMILES | C=CC(=O)Nc1ccc(CNC(=O)CCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-5-15(22)21-14-8-6-13(7-9-14)12-20-16(23)10-11-19-17(24)25-18(2,3)4/h5-9H,1,10-12H2,2-4H3,(H,19,24)(H,20,23)(H,21,22) |
| InChIKey | XZLSALXGHUIXMJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|