C24H31N3O5 — CID 108920539
tert-butyl N-[3-oxo-3-[[4-(3-phenoxypropanoylamino)phenyl]methylamino]propyl]carbamate (PubChem CID 108920539) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl N-[3-oxo-3-[[4-(3-phenoxypropanoylamino)phenyl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-oxo-3-[[4-(3-phenoxypropanoylamino)phenyl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 108920539 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | tert-butyl N-[3-oxo-3-[[4-(3-phenoxypropanoylamino)phenyl]methylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC(=O)NCc1ccc(NC(=O)CCOc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-24(2,3)32-23(30)25-15-13-21(28)26-17-18-9-11-19(12-10-18)27-22(29)14-16-31-20-7-5-4-6-8-20/h4-12H,13-17H2,1-3H3,(H,25,30)(H,26,28)(H,27,29) |
| InChIKey | JADFVHHTPVFOBY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |