C20H30N2O3 — CID 176920069
tert-butyl N-[[4-[[(E)-2-ethenylbut-2-enoyl]amino]phenyl]methyl]carbamate;ethane (PubChem CID 176920069) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is tert-butyl N-[[4-[[(E)-2-ethenylbut-2-enoyl]amino]phenyl]methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[[4-[[(E)-2-ethenylbut-2-enoyl]amino]phenyl]methyl]carbamate;ethane |
|---|---|
| PubChem CID | 176920069 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | tert-butyl N-[[4-[[(E)-2-ethenylbut-2-enoyl]amino]phenyl]methyl]carbamate;ethane |
| SMILES | C=C/C(=C\C)C(=O)Nc1ccc(CNC(=O)OC(C)(C)C)cc1.CC |
| InChI | InChI=1S/C18H24N2O3.C2H6/c1-6-14(7-2)16(21)20-15-10-8-13(9-11-15)12-19-17(22)23-18(3,4)5;1-2/h6-11H,1,12H2,2-5H3,(H,19,22)(H,20,21);1-2H3/b14-7+; |
| InChIKey | RAVRILADZFUOTB-FJUODKGNSA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|