C12H19N3O2S — CID 142539793
tert-butyl N-[[4-(aminosulfanylamino)phenyl]methyl]carbamate (PubChem CID 142539793) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is tert-butyl N-[[4-(aminosulfanylamino)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(aminosulfanylamino)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142539793 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | tert-butyl N-[[4-(aminosulfanylamino)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(NSN)cc1 |
| InChI | InChI=1S/C12H19N3O2S/c1-12(2,3)17-11(16)14-8-9-4-6-10(7-5-9)15-18-13/h4-7,15H,8,13H2,1-3H3,(H,14,16) |
| InChIKey | KPUKWQJUQYAPMZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|