C18H27NO3 — CID 139474554
tert-butyl N-[[4-(2,3-dimethylbutanoyl)phenyl]methyl]carbamate (PubChem CID 139474554) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-[[4-(2,3-dimethylbutanoyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(2,3-dimethylbutanoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 139474554 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl N-[[4-(2,3-dimethylbutanoyl)phenyl]methyl]carbamate |
| SMILES | CC(C)C(C)C(=O)c1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-12(2)13(3)16(20)15-9-7-14(8-10-15)11-19-17(21)22-18(4,5)6/h7-10,12-13H,11H2,1-6H3,(H,19,21) |
| InChIKey | JITFSLMQYTWMCO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |