C15H25N3O2 — CID 142209832
tert-butyl N-[[4-(3-hydrazinylpropyl)phenyl]methyl]carbamate (PubChem CID 142209832) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[[4-(3-hydrazinylpropyl)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-(3-hydrazinylpropyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 142209832 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | tert-butyl N-[[4-(3-hydrazinylpropyl)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ccc(CCCNN)cc1 |
| InChI | InChI=1S/C15H25N3O2/c1-15(2,3)20-14(19)17-11-13-8-6-12(7-9-13)5-4-10-18-16/h6-9,18H,4-5,10-11,16H2,1-3H3,(H,17,19) |
| InChIKey | GQNPXOGTRFGPHS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|