C21H33N3O5 — CID 163196886
tert-butyl N-[[4-[2-[4-(ethoxycarbonylamino)butanoylamino]ethyl]phenyl]methyl]carbamate (PubChem CID 163196886) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is tert-butyl N-[[4-[2-[4-(ethoxycarbonylamino)butanoylamino]ethyl]phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[2-[4-(ethoxycarbonylamino)butanoylamino]ethyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 163196886 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | tert-butyl N-[[4-[2-[4-(ethoxycarbonylamino)butanoylamino]ethyl]phenyl]methyl]carbamate |
| SMILES | CCOC(=O)NCCCC(=O)NCCc1ccc(CNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H33N3O5/c1-5-28-19(26)23-13-6-7-18(25)22-14-12-16-8-10-17(11-9-16)15-24-20(27)29-21(2,3)4/h8-11H,5-7,12-15H2,1-4H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | RDZGCAOGPXLYSZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|