C17H25IN2O3 — CID 177072985
tert-butyl N-[2-[4-(4-iodophenyl)butanoylamino]ethyl]carbamate (PubChem CID 177072985) has the molecular formula C17H25IN2O3 and a molecular weight of 432.30 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-iodophenyl)butanoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-iodophenyl)butanoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 177072985 |
| Molecular Formula | C17H25IN2O3 |
| Molecular Weight | 432.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | tert-butyl N-[2-[4-(4-iodophenyl)butanoylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)CCCc1ccc(I)cc1 |
| InChI | InChI=1S/C17H25IN2O3/c1-17(2,3)23-16(22)20-12-11-19-15(21)6-4-5-13-7-9-14(18)10-8-13/h7-10H,4-6,11-12H2,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | KDUFXHRSRPQNBH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|