C21H28I2N2O2 — CID 161470300
tert-butyl N-[2-(4-iodophenyl)ethyl]carbamate;2-(4-iodophenyl)ethanamine (PubChem CID 161470300) has the molecular formula C21H28I2N2O2 and a molecular weight of 594.28 g/mol. Its IUPAC name is tert-butyl N-[2-(4-iodophenyl)ethyl]carbamate;2-(4-iodophenyl)ethanamine.
| Compound Name | tert-butyl N-[2-(4-iodophenyl)ethyl]carbamate;2-(4-iodophenyl)ethanamine |
|---|---|
| PubChem CID | 161470300 |
| Molecular Formula | C21H28I2N2O2 |
| Molecular Weight | 594.28 g/mol |
| Exact Mass | 594.02 |
| IUPAC Name | tert-butyl N-[2-(4-iodophenyl)ethyl]carbamate;2-(4-iodophenyl)ethanamine |
| SMILES | CC(C)(C)OC(=O)NCCc1ccc(I)cc1.NCCc1ccc(I)cc1 |
| InChI | InChI=1S/C13H18INO2.C8H10IN/c1-13(2,3)17-12(16)15-9-8-10-4-6-11(14)7-5-10;9-8-3-1-7(2-4-8)5-6-10/h4-7H,8-9H2,1-3H3,(H,15,16);1-4H,5-6,10H2 |
| InChIKey | WCZKBRNSXNYKEW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.28 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|