C16H24INO3 — CID 106508729
tert-butyl N-[2-(hydroxymethyl)-3-(4-iodophenyl)-2-methylpropyl]carbamate (PubChem CID 106508729) has the molecular formula C16H24INO3 and a molecular weight of 405.28 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxymethyl)-3-(4-iodophenyl)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(hydroxymethyl)-3-(4-iodophenyl)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 106508729 |
| Molecular Formula | C16H24INO3 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | tert-butyl N-[2-(hydroxymethyl)-3-(4-iodophenyl)-2-methylpropyl]carbamate |
| SMILES | CC(CO)(CNC(=O)OC(C)(C)C)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C16H24INO3/c1-15(2,3)21-14(20)18-10-16(4,11-19)9-12-5-7-13(17)8-6-12/h5-8,19H,9-11H2,1-4H3,(H,18,20) |
| InChIKey | DEIZGGDDYGYCTM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|