C14H20INO3 — CID 45358210
tert-butyl N-[1-hydroxy-3-(4-iodophenyl)propan-2-yl]carbamate (PubChem CID 45358210) has the molecular formula C14H20INO3 and a molecular weight of 377.22 g/mol. Its IUPAC name is tert-butyl N-[1-hydroxy-3-(4-iodophenyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-hydroxy-3-(4-iodophenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 45358210 |
| Molecular Formula | C14H20INO3 |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | tert-butyl N-[1-hydroxy-3-(4-iodophenyl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)Cc1ccc(I)cc1 |
| InChI | InChI=1S/C14H20INO3/c1-14(2,3)19-13(18)16-12(9-17)8-10-4-6-11(15)7-5-10/h4-7,12,17H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | IHPVVBDNLUZOLT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|