C18H30N2O5S — CID 10861991
tert-butyl N-[1-[4-(tert-butylsulfamoyl)phenyl]-3-hydroxypropan-2-yl]carbamate (PubChem CID 10861991) has the molecular formula C18H30N2O5S and a molecular weight of 386.51 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(tert-butylsulfamoyl)phenyl]-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(tert-butylsulfamoyl)phenyl]-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10861991 |
| Molecular Formula | C18H30N2O5S |
| Molecular Weight | 386.51 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | tert-butyl N-[1-[4-(tert-butylsulfamoyl)phenyl]-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(CC(CO)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O5S/c1-17(2,3)20-26(23,24)15-9-7-13(8-10-15)11-14(12-21)19-16(22)25-18(4,5)6/h7-10,14,20-21H,11-12H2,1-6H3,(H,19,22) |
| InChIKey | YBVLAAJJUHJITO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |