C20H24N2O5 — CID 86586019
tert-butyl N-[(2S)-1-[4-[(5-formyl-2-pyridinyl)oxy]phenyl]-3-hydroxypropan-2-yl]carbamate (PubChem CID 86586019) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[(5-formyl-2-pyridinyl)oxy]phenyl]-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[(5-formyl-2-pyridinyl)oxy]phenyl]-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86586019 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[(5-formyl-2-pyridinyl)oxy]phenyl]-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)Cc1ccc(Oc2ccc(C=O)cn2)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-20(2,3)27-19(25)22-16(13-24)10-14-4-7-17(8-5-14)26-18-9-6-15(12-23)11-21-18/h4-9,11-12,16,24H,10,13H2,1-3H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | IWKTZZJQLONJMI-INIZCTEOSA-N |
| XLogP | 3.11 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|