C15H21NO3 — CID 10015626
tert-butyl N-[(2S)-4-oxo-1-phenylbutan-2-yl]carbamate (PubChem CID 10015626) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-oxo-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 10015626 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl N-[(2S)-4-oxo-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2,3)19-14(18)16-13(9-10-17)11-12-7-5-4-6-8-12/h4-8,10,13H,9,11H2,1-3H3,(H,16,18)/t13-/m1/s1 |
| InChIKey | BIUYWIKFGQHAFZ-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|