C16H24N2O3 — CID 175023120
tert-butyl N-(5-amino-5-oxo-1-phenylpentan-2-yl)carbamate (PubChem CID 175023120) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl N-(5-amino-5-oxo-1-phenylpentan-2-yl)carbamate.
| Compound Name | tert-butyl N-(5-amino-5-oxo-1-phenylpentan-2-yl)carbamate |
|---|---|
| PubChem CID | 175023120 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl N-(5-amino-5-oxo-1-phenylpentan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCC(N)=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)21-15(20)18-13(9-10-14(17)19)11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H2,17,19)(H,18,20) |
| InChIKey | KRXDPWRZLUHAAO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |