C14H23NO3S — CID 159653133
tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate;sulfane (PubChem CID 159653133) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate;sulfane.
| Compound Name | tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate;sulfane |
|---|---|
| PubChem CID | 159653133 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate;sulfane |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)Cc1ccccc1.S |
| InChI | InChI=1S/C14H21NO3.H2S/c1-14(2,3)18-13(17)15-12(10-16)9-11-7-5-4-6-8-11;/h4-8,12,16H,9-10H2,1-3H3,(H,15,17);1H2/t12-;/m0./s1 |
| InChIKey | MRVGDJJUHATCFR-YDALLXLXSA-N |
| XLogP | 2.23 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |