C23H31NO3 — CID 19082099
tert-butyl N-(1-hydroxy-5,6-diphenylhexan-2-yl)carbamate (PubChem CID 19082099) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl N-(1-hydroxy-5,6-diphenylhexan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-hydroxy-5,6-diphenylhexan-2-yl)carbamate |
|---|---|
| PubChem CID | 19082099 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | tert-butyl N-(1-hydroxy-5,6-diphenylhexan-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO)CCC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NO3/c1-23(2,3)27-22(26)24-21(17-25)15-14-20(19-12-8-5-9-13-19)16-18-10-6-4-7-11-18/h4-13,20-21,25H,14-17H2,1-3H3,(H,24,26) |
| InChIKey | IREKOADWSXYBSP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |