C21H26FNO3 — CID 58604016
tert-butyl N-[(2S)-1-(3-benzyl-5-fluorophenyl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 58604016) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-benzyl-5-fluorophenyl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-benzyl-5-fluorophenyl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 58604016 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-benzyl-5-fluorophenyl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)Cc1cc(F)cc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H26FNO3/c1-21(2,3)26-20(25)23-19(14-24)13-17-10-16(11-18(22)12-17)9-15-7-5-4-6-8-15/h4-8,10-12,19,24H,9,13-14H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | BHWKQWBWGHHTQI-IBGZPJMESA-N |
| XLogP | 3.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |