C14H20FNO4 — CID 70032049
tert-butyl N-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-3-hydroxypropan-2-yl]carbamate (PubChem CID 70032049) has the molecular formula C14H20FNO4 and a molecular weight of 285.31 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-3-hydroxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-3-hydroxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 70032049 |
| Molecular Formula | C14H20FNO4 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-3-hydroxypropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)Cc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C14H20FNO4/c1-14(2,3)20-13(19)16-10(8-17)6-9-4-5-12(18)11(15)7-9/h4-5,7,10,17-18H,6,8H2,1-3H3,(H,16,19)/t10-/m0/s1 |
| InChIKey | USULFOYRSYTXJD-JTQLQIEISA-N |
| XLogP | 1.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |