C16H25FN2O3 — CID 107686110
tert-butyl N-[2-[(3-fluoro-4-hydroxyphenyl)methylamino]butyl]carbamate (PubChem CID 107686110) has the molecular formula C16H25FN2O3 and a molecular weight of 312.38 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-fluoro-4-hydroxyphenyl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-fluoro-4-hydroxyphenyl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107686110 |
| Molecular Formula | C16H25FN2O3 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | tert-butyl N-[2-[(3-fluoro-4-hydroxyphenyl)methylamino]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)NCc1ccc(O)c(F)c1 |
| InChI | InChI=1S/C16H25FN2O3/c1-5-12(10-19-15(21)22-16(2,3)4)18-9-11-6-7-14(20)13(17)8-11/h6-8,12,18,20H,5,9-10H2,1-4H3,(H,19,21) |
| InChIKey | XQPISFYFUQPVGG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |