C18H26FN3O2 — CID 114017992
tert-butyl N-[2-[(3-cyano-4-fluorophenyl)methylamino]pentyl]carbamate (PubChem CID 114017992) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-cyano-4-fluorophenyl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-cyano-4-fluorophenyl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 114017992 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | tert-butyl N-[2-[(3-cyano-4-fluorophenyl)methylamino]pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NCc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C18H26FN3O2/c1-5-6-15(12-22-17(23)24-18(2,3)4)21-11-13-7-8-16(19)14(9-13)10-20/h7-9,15,21H,5-6,11-12H2,1-4H3,(H,22,23) |
| InChIKey | NFSODFDXCQSDLM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |