C17H27FN2O2 — CID 107253789
tert-butyl N-[2-[(3-fluorophenyl)methylamino]pentyl]carbamate (PubChem CID 107253789) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-fluorophenyl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-fluorophenyl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 107253789 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | tert-butyl N-[2-[(3-fluorophenyl)methylamino]pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NCc1cccc(F)c1 |
| InChI | InChI=1S/C17H27FN2O2/c1-5-7-15(12-20-16(21)22-17(2,3)4)19-11-13-8-6-9-14(18)10-13/h6,8-10,15,19H,5,7,11-12H2,1-4H3,(H,20,21) |
| InChIKey | PAAYSLVKXHHORM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |