C16H29N3O2 — CID 107253653
tert-butyl N-[2-[(1-methylpyrrol-3-yl)methylamino]pentyl]carbamate (PubChem CID 107253653) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is tert-butyl N-[2-[(1-methylpyrrol-3-yl)methylamino]pentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(1-methylpyrrol-3-yl)methylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 107253653 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | tert-butyl N-[2-[(1-methylpyrrol-3-yl)methylamino]pentyl]carbamate |
| SMILES | CCCC(CNC(=O)OC(C)(C)C)NCc1ccn(C)c1 |
| InChI | InChI=1S/C16H29N3O2/c1-6-7-14(11-18-15(20)21-16(2,3)4)17-10-13-8-9-19(5)12-13/h8-9,12,14,17H,6-7,10-11H2,1-5H3,(H,18,20) |
| InChIKey | QYPKVPHBEKPJLR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |