C16H27N3O3 — CID 107251140
tert-butyl N-[2-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]butyl]carbamate (PubChem CID 107251140) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107251140 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | tert-butyl N-[2-[(3-hydroxy-6-methyl-2-pyridinyl)methylamino]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)NCc1nc(C)ccc1O |
| InChI | InChI=1S/C16H27N3O3/c1-6-12(9-18-15(21)22-16(3,4)5)17-10-13-14(20)8-7-11(2)19-13/h7-8,12,17,20H,6,9-10H2,1-5H3,(H,18,21) |
| InChIKey | SQSLYMVAGYTRQI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |