C15H28N4O2 — CID 107251304
tert-butyl N-[2-[(2-ethylpyrazol-3-yl)methylamino]butyl]carbamate (PubChem CID 107251304) has the molecular formula C15H28N4O2 and a molecular weight of 296.42 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-ethylpyrazol-3-yl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-ethylpyrazol-3-yl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107251304 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | tert-butyl N-[2-[(2-ethylpyrazol-3-yl)methylamino]butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)NCc1ccnn1CC |
| InChI | InChI=1S/C15H28N4O2/c1-6-12(10-17-14(20)21-15(3,4)5)16-11-13-8-9-18-19(13)7-2/h8-9,12,16H,6-7,10-11H2,1-5H3,(H,17,20) |
| InChIKey | MVVRWTWIYKCEIB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |