C9H17N3O2 — CID 115762526
2-[(2-ethylpyrazol-3-yl)methylamino]propane-1,3-diol (PubChem CID 115762526) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[(2-ethylpyrazol-3-yl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(2-ethylpyrazol-3-yl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 115762526 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 2-[(2-ethylpyrazol-3-yl)methylamino]propane-1,3-diol |
| SMILES | CCn1nccc1CNC(CO)CO |
| InChI | InChI=1S/C9H17N3O2/c1-2-12-9(3-4-11-12)5-10-8(6-13)7-14/h3-4,8,10,13-14H,2,5-7H2,1H3 |
| InChIKey | LKJBXPIAYLMYPF-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |