C10H19N3O2 — CID 75525234
2-[2-[(2-ethylpyrazol-3-yl)methylamino]ethoxy]ethanol (PubChem CID 75525234) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is 2-[2-[(2-ethylpyrazol-3-yl)methylamino]ethoxy]ethanol.
| Compound Name | 2-[2-[(2-ethylpyrazol-3-yl)methylamino]ethoxy]ethanol |
|---|---|
| PubChem CID | 75525234 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-[2-[(2-ethylpyrazol-3-yl)methylamino]ethoxy]ethanol |
| SMILES | CCn1nccc1CNCCOCCO |
| InChI | InChI=1S/C10H19N3O2/c1-2-13-10(3-4-12-13)9-11-5-7-15-8-6-14/h3-4,11,14H,2,5-9H2,1H3 |
| InChIKey | NTVBJXFFTAMNIO-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|