C10H17N3 — CID 115761680
1-cyclopropyl-N-[(2-ethylpyrazol-3-yl)methyl]methanamine (PubChem CID 115761680) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-cyclopropyl-N-[(2-ethylpyrazol-3-yl)methyl]methanamine.
| Compound Name | 1-cyclopropyl-N-[(2-ethylpyrazol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 115761680 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-cyclopropyl-N-[(2-ethylpyrazol-3-yl)methyl]methanamine |
| SMILES | CCn1nccc1CNCC1CC1 |
| InChI | InChI=1S/C10H17N3/c1-2-13-10(5-6-12-13)8-11-7-9-3-4-9/h5-6,9,11H,2-4,7-8H2,1H3 |
| InChIKey | PHXRYQHBUVHTMC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |