C11H21N3O — CID 104939501
(2R)-2-[(2-propylpyrazol-3-yl)methylamino]butan-1-ol (PubChem CID 104939501) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is (2R)-2-[(2-propylpyrazol-3-yl)methylamino]butan-1-ol.
| Compound Name | (2R)-2-[(2-propylpyrazol-3-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 104939501 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (2R)-2-[(2-propylpyrazol-3-yl)methylamino]butan-1-ol |
| SMILES | CCCn1nccc1CN[C@H](CC)CO |
| InChI | InChI=1S/C11H21N3O/c1-3-7-14-11(5-6-13-14)8-12-10(4-2)9-15/h5-6,10,12,15H,3-4,7-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | JSECNDPAKMRZQW-SNVBAGLBSA-N |
| XLogP | 1.15 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |