C17H32N4O2 — CID 107254264
tert-butyl N-[3-methyl-2-[(2-propylpyrazol-3-yl)methylamino]butyl]carbamate (PubChem CID 107254264) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-2-[(2-propylpyrazol-3-yl)methylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-2-[(2-propylpyrazol-3-yl)methylamino]butyl]carbamate |
|---|---|
| PubChem CID | 107254264 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | tert-butyl N-[3-methyl-2-[(2-propylpyrazol-3-yl)methylamino]butyl]carbamate |
| SMILES | CCCn1nccc1CNC(CNC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C17H32N4O2/c1-7-10-21-14(8-9-20-21)11-18-15(13(2)3)12-19-16(22)23-17(4,5)6/h8-9,13,15,18H,7,10-12H2,1-6H3,(H,19,22) |
| InChIKey | AWPTWINFHYUPEO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |