C18H27N3O2 — CID 107250820
tert-butyl N-[2-(1H-indol-6-ylmethylamino)butyl]carbamate (PubChem CID 107250820) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is tert-butyl N-[2-(1H-indol-6-ylmethylamino)butyl]carbamate.
| Compound Name | tert-butyl N-[2-(1H-indol-6-ylmethylamino)butyl]carbamate |
|---|---|
| PubChem CID | 107250820 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | tert-butyl N-[2-(1H-indol-6-ylmethylamino)butyl]carbamate |
| SMILES | CCC(CNC(=O)OC(C)(C)C)NCc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C18H27N3O2/c1-5-15(12-21-17(22)23-18(2,3)4)20-11-13-6-7-14-8-9-19-16(14)10-13/h6-10,15,19-20H,5,11-12H2,1-4H3,(H,21,22) |
| InChIKey | HIDVLADOJVGSFX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |