C10H25NO10S2 — CID 86663657
tert-butyl N-(1,3-dihydroxypropan-2-yl)carbamate;methanesulfonic acid (PubChem CID 86663657) has the molecular formula C10H25NO10S2 and a molecular weight of 383.44 g/mol. Its IUPAC name is tert-butyl N-(1,3-dihydroxypropan-2-yl)carbamate;methanesulfonic acid.
| Compound Name | tert-butyl N-(1,3-dihydroxypropan-2-yl)carbamate;methanesulfonic acid |
|---|---|
| PubChem CID | 86663657 |
| Molecular Formula | C10H25NO10S2 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | tert-butyl N-(1,3-dihydroxypropan-2-yl)carbamate;methanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)NC(CO)CO.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C8H17NO4.2CH4O3S/c1-8(2,3)13-7(12)9-6(4-10)5-11;2*1-5(2,3)4/h6,10-11H,4-5H2,1-3H3,(H,9,12);2*1H3,(H,2,3,4) |
| InChIKey | LYLNFQKACYROQV-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 187.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|