C11H21NO3 — CID 97300100
tert-butyl N-[(E,2R)-1-hydroxyhex-4-en-2-yl]carbamate (PubChem CID 97300100) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is tert-butyl N-[(E,2R)-1-hydroxyhex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2R)-1-hydroxyhex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 97300100 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | tert-butyl N-[(E,2R)-1-hydroxyhex-4-en-2-yl]carbamate |
| SMILES | C/C=C/C[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO3/c1-5-6-7-9(8-13)12-10(14)15-11(2,3)4/h5-6,9,13H,7-8H2,1-4H3,(H,12,14)/b6-5+/t9-/m1/s1 |
| InChIKey | SUDUBZVFUWTVSC-VUHVRTRXSA-N |
| XLogP | 1.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|