C13H29BNNaO5 — CID 173145039
sodium;boranuide;tert-butyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 173145039) has the molecular formula C13H29BNNaO5 and a molecular weight of 313.18 g/mol. Its IUPAC name is sodium;boranuide;tert-butyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | sodium;boranuide;tert-butyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 173145039 |
| Molecular Formula | C13H29BNNaO5 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | sodium;boranuide;tert-butyl (3R)-4-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CO)NC(=O)OC(C)(C)C.[BH4-].[Na+] |
| InChI | InChI=1S/C13H25NO5.BH4.Na/c1-12(2,3)18-10(16)7-9(8-15)14-11(17)19-13(4,5)6;;/h9,15H,7-8H2,1-6H3,(H,14,17);1H4;/q;-1;+1/t9-;;/m1../s1 |
| InChIKey | PBRHTLRZFNYJII-KLQYNRQASA-N |
| XLogP | -2.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|