C9H16FmNO4- — CID 163370403
tert-butyl 4-hydroxy-3-(oxomethylamino)butanoate;fermium (PubChem CID 163370403) has the molecular formula C9H16FmNO4- and a molecular weight of 459.23 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-3-(oxomethylamino)butanoate;fermium.
| Compound Name | tert-butyl 4-hydroxy-3-(oxomethylamino)butanoate;fermium |
|---|---|
| PubChem CID | 163370403 |
| Molecular Formula | C9H16FmNO4- |
| Molecular Weight | 459.23 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | tert-butyl 4-hydroxy-3-(oxomethylamino)butanoate;fermium |
| SMILES | CC(C)(C)OC(=O)CC(CO)N[C-]=O.[Fm] |
| InChI | InChI=1S/C9H16NO4.Fm/c1-9(2,3)14-8(13)4-7(5-11)10-6-12;/h7,11H,4-5H2,1-3H3,(H,10,12);/q-1; |
| InChIKey | CCIKEHNAEQMXGG-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|