About ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate
ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate (PubChem CID 163821206) has the molecular formula C24H46N2O8
and a molecular weight of 490.64 g/mol. Its IUPAC name is ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate.
Molecular Properties
| Compound Name | ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate |
| PubChem CID | 163821206 |
| Molecular Formula | C24H46N2O8 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](N)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)C[C@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/2C12H23NO4/c2*1-11(2,3)16-9(14)7-8(13)10(15)17-12(4,5)6/h2*8H,7,13H2,1-6H3/t2*8-/m10/s1 |
| InChIKey | NVOBACIMCDLPCH-RMTNWKGQSA-N |
| XLogP | 2.77 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate?
The IUPAC name of ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate (CID 163821206) is ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate.
What is the SMILES notation for ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate?
The canonical SMILES for ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate is CC(C)(C)OC(=O)C[C@@H](N)C(=O)OC(C)(C)C.CC(C)(C)OC(=O)C[C@H](N)C(=O)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate?
The InChIKey is NVOBACIMCDLPCH-RMTNWKGQSA-N. The full InChI is InChI=1S/2C12H23NO4/c2*1-11(2,3)16-9(14)7-8(13)10(15)17-12(4,5)6/h2*8H,7,13H2,1-6H3/t2*8-/m10/s1.
What are the key properties of ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate?
ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate has a molecular weight of 490.64 g/mol, XLogP of 2.77, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2S)-2-aminobutanedioate;ditert-butyl (2R)-2-aminobutanedioate is sourced from PubChem (CID 163821206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).