About 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate
1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate (PubChem CID 14352279) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate |
| PubChem CID | 14352279 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate |
| SMILES | COC(=O)C[C@@H](N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)14-8(12)6(10)5-7(11)13-4/h6H,5,10H2,1-4H3/t6-/m1/s1 |
| InChIKey | WNJFEWOMTHUJAP-ZCFIWIBFSA-N |
| XLogP | 0.22 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate?
The IUPAC name of 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate (CID 14352279) is 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate.
What is the SMILES notation for 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate?
The canonical SMILES for 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate is COC(=O)C[C@@H](N)C(=O)OC(C)(C)C.
What is the InChIKey of 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate?
The InChIKey is WNJFEWOMTHUJAP-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H17NO4/c1-9(2,3)14-8(12)6(10)5-7(11)13-4/h6H,5,10H2,1-4H3/t6-/m1/s1.
What are the key properties of 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate?
1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate has a molecular weight of 203.24 g/mol, XLogP of 0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 4-O-methyl (2R)-2-aminobutanedioate is sourced from PubChem (CID 14352279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).