C11H21NO5 — CID 175589320
tert-butyl 2-amino-3-(3-methoxy-3-oxopropoxy)propanoate (PubChem CID 175589320) has the molecular formula C11H21NO5 and a molecular weight of 247.29 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(3-methoxy-3-oxopropoxy)propanoate.
| Compound Name | tert-butyl 2-amino-3-(3-methoxy-3-oxopropoxy)propanoate |
|---|---|
| PubChem CID | 175589320 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | tert-butyl 2-amino-3-(3-methoxy-3-oxopropoxy)propanoate |
| SMILES | COC(=O)CCOCC(N)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H21NO5/c1-11(2,3)17-10(14)8(12)7-16-6-5-9(13)15-4/h8H,5-7,12H2,1-4H3 |
| InChIKey | ODFFWCFMCROWRO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|