C13H27NO5 — CID 156780297
tert-butyl 3-[2-amino-2-(2-ethoxyethoxy)ethoxy]propanoate (PubChem CID 156780297) has the molecular formula C13H27NO5 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-2-(2-ethoxyethoxy)ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-amino-2-(2-ethoxyethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 156780297 |
| Molecular Formula | C13H27NO5 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | tert-butyl 3-[2-amino-2-(2-ethoxyethoxy)ethoxy]propanoate |
| SMILES | CCOCCOC(N)COCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H27NO5/c1-5-16-8-9-18-11(14)10-17-7-6-12(15)19-13(2,3)4/h11H,5-10,14H2,1-4H3 |
| InChIKey | KOPQWYRLWFYDJB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|