C13H27NO4 — CID 175563215
tert-butyl 5-(2-aminoethoxy)-4-ethoxypentanoate (PubChem CID 175563215) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is tert-butyl 5-(2-aminoethoxy)-4-ethoxypentanoate.
| Compound Name | tert-butyl 5-(2-aminoethoxy)-4-ethoxypentanoate |
|---|---|
| PubChem CID | 175563215 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | tert-butyl 5-(2-aminoethoxy)-4-ethoxypentanoate |
| SMILES | CCOC(CCC(=O)OC(C)(C)C)COCCN |
| InChI | InChI=1S/C13H27NO4/c1-5-17-11(10-16-9-8-14)6-7-12(15)18-13(2,3)4/h11H,5-10,14H2,1-4H3 |
| InChIKey | UUOMZSUUJAXYEM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|