C20H41N3O6 — CID 145199356
tert-butyl 5-[2-(2-aminoethoxy)ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate;ethane (PubChem CID 145199356) has the molecular formula C20H41N3O6 and a molecular weight of 419.56 g/mol. Its IUPAC name is tert-butyl 5-[2-(2-aminoethoxy)ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate;ethane.
| Compound Name | tert-butyl 5-[2-(2-aminoethoxy)ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate;ethane |
|---|---|
| PubChem CID | 145199356 |
| Molecular Formula | C20H41N3O6 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.30 |
| IUPAC Name | tert-butyl 5-[2-(2-aminoethoxy)ethylamino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxopentanoate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)CCC(NC(=O)OC(C)(C)C)C(=O)NCCOCCN |
| InChI | InChI=1S/C18H35N3O6.C2H6/c1-17(2,3)26-14(22)8-7-13(21-16(24)27-18(4,5)6)15(23)20-10-12-25-11-9-19;1-2/h13H,7-12,19H2,1-6H3,(H,20,23)(H,21,24);1-2H3 |
| InChIKey | UTCGOFSSIXFPOU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|